C13H22N4OS2 — CID 65204223
N-(3-amino-3-sulfanylidenepropyl)-N-(2-methylpropyl)-4-propan-2-ylthiadiazole-5-carboxamide (PubChem CID 65204223) has the molecular formula C13H22N4OS2 and a molecular weight of 314.48 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-(2-methylpropyl)-4-propan-2-ylthiadiazole-5-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-(2-methylpropyl)-4-propan-2-ylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65204223 |
| Molecular Formula | C13H22N4OS2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-(2-methylpropyl)-4-propan-2-ylthiadiazole-5-carboxamide |
| SMILES | CC(C)CN(CCC(N)=S)C(=O)c1snnc1C(C)C |
| InChI | InChI=1S/C13H22N4OS2/c1-8(2)7-17(6-5-10(14)19)13(18)12-11(9(3)4)15-16-20-12/h8-9H,5-7H2,1-4H3,(H2,14,19) |
| InChIKey | SFQDHUKNPHPJPK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|