C10H17N3O3S — CID 65204874
N-(2,2-dimethoxyethyl)-4-propylthiadiazole-5-carboxamide (PubChem CID 65204874) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4-propylthiadiazole-5-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-4-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65204874 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4-propylthiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)NCC(OC)OC |
| InChI | InChI=1S/C10H17N3O3S/c1-4-5-7-9(17-13-12-7)10(14)11-6-8(15-2)16-3/h8H,4-6H2,1-3H3,(H,11,14) |
| InChIKey | BEDMKEDUWPHCJP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|