About 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid
2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid (PubChem CID 65205703) has the molecular formula C12H9F2N3O3S
and a molecular weight of 313.29 g/mol. Its IUPAC name is 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid.
Molecular Properties
| Compound Name | 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid |
| PubChem CID | 65205703 |
| Molecular Formula | C12H9F2N3O3S |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid |
| SMILES | CCc1nnsc1C(=O)Nc1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C12H9F2N3O3S/c1-2-8-10(21-17-16-8)11(18)15-9-4-7(14)6(13)3-5(9)12(19)20/h3-4H,2H2,1H3,(H,15,18)(H,19,20) |
| InChIKey | UQBCHEBPBDNXCI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid?
The IUPAC name of 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid (CID 65205703) is 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid.
What is the SMILES notation for 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid?
The canonical SMILES for 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid is CCc1nnsc1C(=O)Nc1cc(F)c(F)cc1C(=O)O.
What is the InChIKey of 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid?
The InChIKey is UQBCHEBPBDNXCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2N3O3S/c1-2-8-10(21-17-16-8)11(18)15-9-4-7(14)6(13)3-5(9)12(19)20/h3-4H,2H2,1H3,(H,15,18)(H,19,20).
What are the key properties of 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid?
2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid has a molecular weight of 313.29 g/mol, XLogP of 2.33, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethylthiadiazole-5-carbonyl)amino]-4,5-difluorobenzoic acid is sourced from PubChem (CID 65205703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).