About [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine
[4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine (PubChem CID 65207998) has the molecular formula C9H7F2N3S
and a molecular weight of 227.24 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine |
| PubChem CID | 65207998 |
| Molecular Formula | C9H7F2N3S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine |
| SMILES | NCc1snnc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H7F2N3S/c10-6-2-1-5(3-7(6)11)9-8(4-12)15-14-13-9/h1-3H,4,12H2 |
| InChIKey | WPVKUCYIIZUGSZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine?
The IUPAC name of [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine (CID 65207998) is [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine.
What is the SMILES notation for [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine?
The canonical SMILES for [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine is NCc1snnc1-c1ccc(F)c(F)c1.
What is the InChIKey of [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine?
The InChIKey is WPVKUCYIIZUGSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F2N3S/c10-6-2-1-5(3-7(6)11)9-8(4-12)15-14-13-9/h1-3H,4,12H2.
What are the key properties of [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine?
[4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine has a molecular weight of 227.24 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-difluorophenyl)thiadiazol-5-yl]methanamine is sourced from PubChem (CID 65207998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).