C8H16N4S — CID 65208285
N-ethyl-N'-methyl-N'-(5-methyl-1,3,4-thiadiazol-2-yl)ethane-1,2-diamine (PubChem CID 65208285) has the molecular formula C8H16N4S and a molecular weight of 200.31 g/mol. Its IUPAC name is N-ethyl-N'-methyl-N'-(5-methyl-1,3,4-thiadiazol-2-yl)ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-methyl-N'-(5-methyl-1,3,4-thiadiazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65208285 |
| Molecular Formula | C8H16N4S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N-ethyl-N'-methyl-N'-(5-methyl-1,3,4-thiadiazol-2-yl)ethane-1,2-diamine |
| SMILES | CCNCCN(C)c1nnc(C)s1 |
| InChI | InChI=1S/C8H16N4S/c1-4-9-5-6-12(3)8-11-10-7(2)13-8/h9H,4-6H2,1-3H3 |
| InChIKey | LHQHSZDIVSMUGV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|