About N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine
N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine (PubChem CID 65208286) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine.
Molecular Properties
| Compound Name | N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine |
| PubChem CID | 65208286 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine |
| SMILES | CNC(C)C(C)c1nnc(C)s1 |
| InChI | InChI=1S/C8H15N3S/c1-5(6(2)9-4)8-11-10-7(3)12-8/h5-6,9H,1-4H3 |
| InChIKey | XRVXDPMNXGFNHO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine?
The IUPAC name of N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine (CID 65208286) is N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine.
What is the SMILES notation for N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine?
The canonical SMILES for N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine is CNC(C)C(C)c1nnc(C)s1.
What is the InChIKey of N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine?
The InChIKey is XRVXDPMNXGFNHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3S/c1-5(6(2)9-4)8-11-10-7(3)12-8/h5-6,9H,1-4H3.
What are the key properties of N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine?
N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine has a molecular weight of 185.30 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-amine is sourced from PubChem (CID 65208286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).