About 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole
2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole (PubChem CID 65208349) has the molecular formula C10H17ClN4S
and a molecular weight of 260.79 g/mol. Its IUPAC name is 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole |
| PubChem CID | 65208349 |
| Molecular Formula | C10H17ClN4S |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(N2CCCN(CCCl)CC2)s1 |
| InChI | InChI=1S/C10H17ClN4S/c1-9-12-13-10(16-9)15-5-2-4-14(6-3-11)7-8-15/h2-8H2,1H3 |
| InChIKey | YKTRICQAAGEFKR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole?
The IUPAC name of 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole (CID 65208349) is 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole.
What is the SMILES notation for 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole?
The canonical SMILES for 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole is Cc1nnc(N2CCCN(CCCl)CC2)s1.
What is the InChIKey of 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole?
The InChIKey is YKTRICQAAGEFKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClN4S/c1-9-12-13-10(16-9)15-5-2-4-14(6-3-11)7-8-15/h2-8H2,1H3.
What are the key properties of 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole?
2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole has a molecular weight of 260.79 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole is sourced from PubChem (CID 65208349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).