About 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine
2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine (PubChem CID 65208518) has the molecular formula C11H21N3S
and a molecular weight of 227.38 g/mol. Its IUPAC name is 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine.
Molecular Properties
| Compound Name | 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine |
| PubChem CID | 65208518 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine |
| SMILES | CCCNC(CC)C(C)c1nnc(C)s1 |
| InChI | InChI=1S/C11H21N3S/c1-5-7-12-10(6-2)8(3)11-14-13-9(4)15-11/h8,10,12H,5-7H2,1-4H3 |
| InChIKey | WJXJLGVXSOLRTJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine?
The IUPAC name of 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine (CID 65208518) is 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine.
What is the SMILES notation for 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine?
The canonical SMILES for 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine is CCCNC(CC)C(C)c1nnc(C)s1.
What is the InChIKey of 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine?
The InChIKey is WJXJLGVXSOLRTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3S/c1-5-7-12-10(6-2)8(3)11-14-13-9(4)15-11/h8,10,12H,5-7H2,1-4H3.
What are the key properties of 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine?
2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine has a molecular weight of 227.38 g/mol, XLogP of 2.73, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-propylpentan-3-amine is sourced from PubChem (CID 65208518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).