C12H23NOS — CID 65208589
1-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-ol (PubChem CID 65208589) has the molecular formula C12H23NOS and a molecular weight of 229.39 g/mol. Its IUPAC name is 1-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-ol.
| Compound Name | 1-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 65208589 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 1-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-ol |
| SMILES | OC1(CN2CCCSCC2)CCCCC1 |
| InChI | InChI=1S/C12H23NOS/c14-12(5-2-1-3-6-12)11-13-7-4-9-15-10-8-13/h14H,1-11H2 |
| InChIKey | WNDPWYCZXDVUGH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |