C8H14N4S2 — CID 65209035
2-methyl-3-[methyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]propanethioamide (PubChem CID 65209035) has the molecular formula C8H14N4S2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 2-methyl-3-[methyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]propanethioamide.
| Compound Name | 2-methyl-3-[methyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]propanethioamide |
|---|---|
| PubChem CID | 65209035 |
| Molecular Formula | C8H14N4S2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-methyl-3-[methyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]propanethioamide |
| SMILES | Cc1nnc(N(C)CC(C)C(N)=S)s1 |
| InChI | InChI=1S/C8H14N4S2/c1-5(7(9)13)4-12(3)8-11-10-6(2)14-8/h5H,4H2,1-3H3,(H2,9,13) |
| InChIKey | FKVZTBDQCNITBI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|