C12H23N5S — CID 65209201
4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)-1,4-diazepan-1-yl]butan-1-amine (PubChem CID 65209201) has the molecular formula C12H23N5S and a molecular weight of 269.42 g/mol. Its IUPAC name is 4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)-1,4-diazepan-1-yl]butan-1-amine.
| Compound Name | 4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)-1,4-diazepan-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 65209201 |
| Molecular Formula | C12H23N5S |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)-1,4-diazepan-1-yl]butan-1-amine |
| SMILES | Cc1nnc(N2CCCN(CCCCN)CC2)s1 |
| InChI | InChI=1S/C12H23N5S/c1-11-14-15-12(18-11)17-8-4-7-16(9-10-17)6-3-2-5-13/h2-10,13H2,1H3 |
| InChIKey | JNPKPKKLJVQTEK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|