About 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole
2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole (PubChem CID 65209413) has the molecular formula C8H14N4S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole |
| PubChem CID | 65209413 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(N2CCCNCC2)s1 |
| InChI | InChI=1S/C8H14N4S/c1-7-10-11-8(13-7)12-5-2-3-9-4-6-12/h9H,2-6H2,1H3 |
| InChIKey | RBVFYHVMGVPBHL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole?
The IUPAC name of 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole (CID 65209413) is 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole.
What is the SMILES notation for 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole?
The canonical SMILES for 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole is Cc1nnc(N2CCCNCC2)s1.
What is the InChIKey of 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole?
The InChIKey is RBVFYHVMGVPBHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4S/c1-7-10-11-8(13-7)12-5-2-3-9-4-6-12/h9H,2-6H2,1H3.
What are the key properties of 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole?
2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole has a molecular weight of 198.29 g/mol, XLogP of 0.65, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazepan-1-yl)-5-methyl-1,3,4-thiadiazole is sourced from PubChem (CID 65209413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).