About 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine
2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine (PubChem CID 65209580) has the molecular formula C9H12N4OS2
and a molecular weight of 256.36 g/mol. Its IUPAC name is 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine |
| PubChem CID | 65209580 |
| Molecular Formula | C9H12N4OS2 |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine |
| SMILES | COCCNCc1snnc1-c1nccs1 |
| InChI | InChI=1S/C9H12N4OS2/c1-14-4-2-10-6-7-8(12-13-16-7)9-11-3-5-15-9/h3,5,10H,2,4,6H2,1H3 |
| InChIKey | SRUGOZCAUJQPFS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine?
The IUPAC name of 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine (CID 65209580) is 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine.
What is the SMILES notation for 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine?
The canonical SMILES for 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine is COCCNCc1snnc1-c1nccs1.
What is the InChIKey of 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine?
The InChIKey is SRUGOZCAUJQPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4OS2/c1-14-4-2-10-6-7-8(12-13-16-7)9-11-3-5-15-9/h3,5,10H,2,4,6H2,1H3.
What are the key properties of 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine?
2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine has a molecular weight of 256.36 g/mol, XLogP of 1.40, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-[[4-(1,3-thiazol-2-yl)thiadiazol-5-yl]methyl]ethanamine is sourced from PubChem (CID 65209580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).