C11H19N3OS — CID 65210557
4-tert-butyl-N,N-diethylthiadiazole-5-carboxamide (PubChem CID 65210557) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 4-tert-butyl-N,N-diethylthiadiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N,N-diethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65210557 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-tert-butyl-N,N-diethylthiadiazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C11H19N3OS/c1-6-14(7-2)10(15)8-9(11(3,4)5)12-13-16-8/h6-7H2,1-5H3 |
| InChIKey | ZXIQHUHNZBZGFC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |