About 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate
2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate (PubChem CID 65211623) has the molecular formula C6H10N4O2S
and a molecular weight of 202.24 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate.
Molecular Properties
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate |
| PubChem CID | 65211623 |
| Molecular Formula | C6H10N4O2S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C6H10N4O2S/c7-5(8)13-2-1-10-4(11)3-9-6(10)12/h1-3H2,(H3,7,8)(H,9,12) |
| InChIKey | QZEOIHJVJUAYAO-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate?
The IUPAC name of 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate (CID 65211623) is 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate.
What is the SMILES notation for 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate?
The canonical SMILES for 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate is [H]/N=C(\N)SCCN1C(=O)CNC1=O.
What is the InChIKey of 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate?
The InChIKey is QZEOIHJVJUAYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O2S/c7-5(8)13-2-1-10-4(11)3-9-6(10)12/h1-3H2,(H3,7,8)(H,9,12).
What are the key properties of 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate?
2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate has a molecular weight of 202.24 g/mol, XLogP of -0.84, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxoimidazolidin-1-yl)ethyl carbamimidothioate is sourced from PubChem (CID 65211623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).