About [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea
[(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea (PubChem CID 65211711) has the molecular formula C9H11N3S2
and a molecular weight of 225.34 g/mol. Its IUPAC name is [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea.
Molecular Properties
| Compound Name | [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea |
| PubChem CID | 65211711 |
| Molecular Formula | C9H11N3S2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea |
| SMILES | NC(=S)N/N=C1/CCCc2sccc21 |
| InChI | InChI=1S/C9H11N3S2/c10-9(13)12-11-7-2-1-3-8-6(7)4-5-14-8/h4-5H,1-3H2,(H3,10,12,13)/b11-7- |
| InChIKey | JQRKVIYQIRHARQ-XFFZJAGNSA-N |
| XLogP | 1.62 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea?
The IUPAC name of [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea (CID 65211711) is [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea.
What is the SMILES notation for [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea?
The canonical SMILES for [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea is NC(=S)N/N=C1/CCCc2sccc21.
What is the InChIKey of [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea?
The InChIKey is JQRKVIYQIRHARQ-XFFZJAGNSA-N. The full InChI is InChI=1S/C9H11N3S2/c10-9(13)12-11-7-2-1-3-8-6(7)4-5-14-8/h4-5H,1-3H2,(H3,10,12,13)/b11-7-.
What are the key properties of [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea?
[(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea has a molecular weight of 225.34 g/mol, XLogP of 1.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]thiourea is sourced from PubChem (CID 65211711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).