About [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea
[(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea (PubChem CID 65211826) has the molecular formula C8H15N3OS
and a molecular weight of 201.29 g/mol. Its IUPAC name is [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea.
Molecular Properties
| Compound Name | [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea |
| PubChem CID | 65211826 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea |
| SMILES | CC1(C)C/C(=N\NC(N)=S)CCO1 |
| InChI | InChI=1S/C8H15N3OS/c1-8(2)5-6(3-4-12-8)10-11-7(9)13/h3-5H2,1-2H3,(H3,9,11,13)/b10-6- |
| InChIKey | XELNTHMHKQBDOD-POHAHGRESA-N |
| XLogP | 0.76 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea?
The IUPAC name of [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea (CID 65211826) is [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea.
What is the SMILES notation for [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea?
The canonical SMILES for [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea is CC1(C)C/C(=N\NC(N)=S)CCO1.
What is the InChIKey of [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea?
The InChIKey is XELNTHMHKQBDOD-POHAHGRESA-N. The full InChI is InChI=1S/C8H15N3OS/c1-8(2)5-6(3-4-12-8)10-11-7(9)13/h3-5H2,1-2H3,(H3,9,11,13)/b10-6-.
What are the key properties of [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea?
[(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea has a molecular weight of 201.29 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(2,2-dimethyloxan-4-ylidene)amino]thiourea is sourced from PubChem (CID 65211826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).