About (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate
(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate (PubChem CID 65212039) has the molecular formula C11H12N4OS
and a molecular weight of 248.31 g/mol. Its IUPAC name is (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate.
Molecular Properties
| Compound Name | (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate |
| PubChem CID | 65212039 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1cc(=O)n2cccc(C)c2n1 |
| InChI | InChI=1S/C11H12N4OS/c1-7-3-2-4-15-9(16)5-8(14-10(7)15)6-17-11(12)13/h2-5H,6H2,1H3,(H3,12,13) |
| InChIKey | FPAOBFPRUPVGKG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate?
The IUPAC name of (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate (CID 65212039) is (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate.
What is the SMILES notation for (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate?
The canonical SMILES for (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate is [H]/N=C(\N)SCc1cc(=O)n2cccc(C)c2n1.
What is the InChIKey of (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate?
The InChIKey is FPAOBFPRUPVGKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4OS/c1-7-3-2-4-15-9(16)5-8(14-10(7)15)6-17-11(12)13/h2-5H,6H2,1H3,(H3,12,13).
What are the key properties of (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate?
(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate has a molecular weight of 248.31 g/mol, XLogP of 1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl carbamimidothioate is sourced from PubChem (CID 65212039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).