About 1-methoxypropan-2-yl carbamimidothioate
1-methoxypropan-2-yl carbamimidothioate (PubChem CID 65212392) has the molecular formula C5H12N2OS
and a molecular weight of 148.23 g/mol. Its IUPAC name is 1-methoxypropan-2-yl carbamimidothioate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl carbamimidothioate |
| PubChem CID | 65212392 |
| Molecular Formula | C5H12N2OS |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 1-methoxypropan-2-yl carbamimidothioate |
| SMILES | [H]/N=C(\N)SC(C)COC |
| InChI | InChI=1S/C5H12N2OS/c1-4(3-8-2)9-5(6)7/h4H,3H2,1-2H3,(H3,6,7) |
| InChIKey | TYVMMIIEKGZLSH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypropan-2-yl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl carbamimidothioate?
The IUPAC name of 1-methoxypropan-2-yl carbamimidothioate (CID 65212392) is 1-methoxypropan-2-yl carbamimidothioate.
What is the SMILES notation for 1-methoxypropan-2-yl carbamimidothioate?
The canonical SMILES for 1-methoxypropan-2-yl carbamimidothioate is [H]/N=C(\N)SC(C)COC.
What is the InChIKey of 1-methoxypropan-2-yl carbamimidothioate?
The InChIKey is TYVMMIIEKGZLSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2OS/c1-4(3-8-2)9-5(6)7/h4H,3H2,1-2H3,(H3,6,7).
What are the key properties of 1-methoxypropan-2-yl carbamimidothioate?
1-methoxypropan-2-yl carbamimidothioate has a molecular weight of 148.23 g/mol, XLogP of 0.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl carbamimidothioate is sourced from PubChem (CID 65212392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).