C10H12N4OS2 — CID 65212395
(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl carbamimidothioate (PubChem CID 65212395) has the molecular formula C10H12N4OS2 and a molecular weight of 268.37 g/mol. Its IUPAC name is (5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl carbamimidothioate.
| Compound Name | (5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl carbamimidothioate |
|---|---|
| PubChem CID | 65212395 |
| Molecular Formula | C10H12N4OS2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1nc2sc(C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N4OS2/c1-4-5(2)17-9-7(4)8(15)13-6(14-9)3-16-10(11)12/h3H2,1-2H3,(H3,11,12)(H,13,14,15) |
| InChIKey | FJHFQCRSYHQKCS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 95.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|