About 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol
1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol (PubChem CID 65212683) has the molecular formula C11H17ClN2O
and a molecular weight of 228.72 g/mol. Its IUPAC name is 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol |
| PubChem CID | 65212683 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol |
| SMILES | Cc1nn(CC2(O)CCCC2)c(C)c1Cl |
| InChI | InChI=1S/C11H17ClN2O/c1-8-10(12)9(2)14(13-8)7-11(15)5-3-4-6-11/h15H,3-7H2,1-2H3 |
| InChIKey | GHULKHWDQVGJCI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol?
The IUPAC name of 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol (CID 65212683) is 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol.
What is the SMILES notation for 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol?
The canonical SMILES for 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol is Cc1nn(CC2(O)CCCC2)c(C)c1Cl.
What is the InChIKey of 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol?
The InChIKey is GHULKHWDQVGJCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN2O/c1-8-10(12)9(2)14(13-8)7-11(15)5-3-4-6-11/h15H,3-7H2,1-2H3.
What are the key properties of 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol?
1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol has a molecular weight of 228.72 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclopentan-1-ol is sourced from PubChem (CID 65212683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).