C14H20O3 — CID 65212811
1-[[3-[(1S)-1-hydroxyethyl]phenoxy]methyl]cyclopentan-1-ol (PubChem CID 65212811) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-[[3-[(1S)-1-hydroxyethyl]phenoxy]methyl]cyclopentan-1-ol.
| Compound Name | 1-[[3-[(1S)-1-hydroxyethyl]phenoxy]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 65212811 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-[[3-[(1S)-1-hydroxyethyl]phenoxy]methyl]cyclopentan-1-ol |
| SMILES | C[C@H](O)c1cccc(OCC2(O)CCCC2)c1 |
| InChI | InChI=1S/C14H20O3/c1-11(15)12-5-4-6-13(9-12)17-10-14(16)7-2-3-8-14/h4-6,9,11,15-16H,2-3,7-8,10H2,1H3/t11-/m0/s1 |
| InChIKey | ZXSQMXPDIWSBTK-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |