About 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol
1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol (PubChem CID 65212859) has the molecular formula C8H13N3OS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol |
| PubChem CID | 65212859 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol |
| SMILES | OC1(CSc2ncn[nH]2)CCCC1 |
| InChI | InChI=1S/C8H13N3OS/c12-8(3-1-2-4-8)5-13-7-9-6-10-11-7/h6,12H,1-5H2,(H,9,10,11) |
| InChIKey | RBFRXBWFBGZDTF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol?
The IUPAC name of 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol (CID 65212859) is 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol.
What is the SMILES notation for 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol?
The canonical SMILES for 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol is OC1(CSc2ncn[nH]2)CCCC1.
What is the InChIKey of 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol?
The InChIKey is RBFRXBWFBGZDTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS/c12-8(3-1-2-4-8)5-13-7-9-6-10-11-7/h6,12H,1-5H2,(H,9,10,11).
What are the key properties of 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol?
1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol has a molecular weight of 199.28 g/mol, XLogP of 1.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-1,2,4-triazol-5-ylsulfanylmethyl)cyclopentan-1-ol is sourced from PubChem (CID 65212859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).