C15H22FNO2 — CID 65213345
1-[[2-[(1R)-1-aminoethyl]-5-fluorophenoxy]methyl]cyclohexan-1-ol (PubChem CID 65213345) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 1-[[2-[(1R)-1-aminoethyl]-5-fluorophenoxy]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[2-[(1R)-1-aminoethyl]-5-fluorophenoxy]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65213345 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-[[2-[(1R)-1-aminoethyl]-5-fluorophenoxy]methyl]cyclohexan-1-ol |
| SMILES | C[C@@H](N)c1ccc(F)cc1OCC1(O)CCCCC1 |
| InChI | InChI=1S/C15H22FNO2/c1-11(17)13-6-5-12(16)9-14(13)19-10-15(18)7-3-2-4-8-15/h5-6,9,11,18H,2-4,7-8,10,17H2,1H3/t11-/m1/s1 |
| InChIKey | IDCSKESPEXJEAJ-LLVKDONJSA-N |
| XLogP | 2.92 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |