About 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol
1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol (PubChem CID 65213423) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol |
| PubChem CID | 65213423 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol |
| SMILES | NCCC1CN(CC2(O)CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C17H26N2O/c18-11-8-14-12-19(16-7-3-2-6-15(14)16)13-17(20)9-4-1-5-10-17/h2-3,6-7,14,20H,1,4-5,8-13,18H2 |
| InChIKey | MMWQWGMHADJJKN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol?
The IUPAC name of 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol (CID 65213423) is 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol?
The canonical SMILES for 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol is NCCC1CN(CC2(O)CCCCC2)c2ccccc21.
What is the InChIKey of 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol?
The InChIKey is MMWQWGMHADJJKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O/c18-11-8-14-12-19(16-7-3-2-6-15(14)16)13-17(20)9-4-1-5-10-17/h2-3,6-7,14,20H,1,4-5,8-13,18H2.
What are the key properties of 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol?
1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol has a molecular weight of 274.41 g/mol, XLogP of 2.63, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]methyl]cyclohexan-1-ol is sourced from PubChem (CID 65213423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).