About [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea
[(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea (PubChem CID 65214168) has the molecular formula C6H11N5O2S2
and a molecular weight of 249.32 g/mol. Its IUPAC name is [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea.
Molecular Properties
| Compound Name | [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea |
| PubChem CID | 65214168 |
| Molecular Formula | C6H11N5O2S2 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea |
| SMILES | Cc1nc(S(=O)(=O)NNC(N)=S)cn1C |
| InChI | InChI=1S/C6H11N5O2S2/c1-4-8-5(3-11(4)2)15(12,13)10-9-6(7)14/h3,10H,1-2H3,(H3,7,9,14) |
| InChIKey | VMNDZSQXIODEOS-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea?
The IUPAC name of [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea (CID 65214168) is [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea.
What is the SMILES notation for [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea?
The canonical SMILES for [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea is Cc1nc(S(=O)(=O)NNC(N)=S)cn1C.
What is the InChIKey of [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea?
The InChIKey is VMNDZSQXIODEOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5O2S2/c1-4-8-5(3-11(4)2)15(12,13)10-9-6(7)14/h3,10H,1-2H3,(H3,7,9,14).
What are the key properties of [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea?
[(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea has a molecular weight of 249.32 g/mol, XLogP of -1.24, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1,2-dimethylimidazol-4-yl)sulfonylamino]thiourea is sourced from PubChem (CID 65214168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).