C7H13N3O2S — CID 65214510
[[2-(oxolan-2-yl)acetyl]amino]thiourea (PubChem CID 65214510) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is [[2-(oxolan-2-yl)acetyl]amino]thiourea.
| Compound Name | [[2-(oxolan-2-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 65214510 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | [[2-(oxolan-2-yl)acetyl]amino]thiourea |
| SMILES | NC(=S)NNC(=O)CC1CCCO1 |
| InChI | InChI=1S/C7H13N3O2S/c8-7(13)10-9-6(11)4-5-2-1-3-12-5/h5H,1-4H2,(H,9,11)(H3,8,10,13) |
| InChIKey | NHCNZYUVVBGPJM-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|