About 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine
5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 65214775) has the molecular formula C4H3N5OS
and a molecular weight of 169.17 g/mol. Its IUPAC name is 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine |
| PubChem CID | 65214775 |
| Molecular Formula | C4H3N5OS |
| Molecular Weight | 169.17 g/mol |
| Exact Mass | 169.01 |
| IUPAC Name | 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(-c2csnn2)o1 |
| InChI | InChI=1S/C4H3N5OS/c5-4-8-7-3(10-4)2-1-11-9-6-2/h1H,(H2,5,8) |
| InChIKey | XACXOUPOXPVERR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.17 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine (CID 65214775) is 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine is Nc1nnc(-c2csnn2)o1.
What is the InChIKey of 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine?
The InChIKey is XACXOUPOXPVERR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N5OS/c5-4-8-7-3(10-4)2-1-11-9-6-2/h1H,(H2,5,8).
What are the key properties of 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine?
5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine has a molecular weight of 169.17 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 65214775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).