C13H12N6S — CID 65216249
4-(8-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)thiadiazole (PubChem CID 65216249) has the molecular formula C13H12N6S and a molecular weight of 284.35 g/mol. Its IUPAC name is 4-(8-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)thiadiazole.
| Compound Name | 4-(8-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)thiadiazole |
|---|---|
| PubChem CID | 65216249 |
| Molecular Formula | C13H12N6S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(8-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)thiadiazole |
| SMILES | c1ccc(C2NCCn3c(-c4csnn4)nnc32)cc1 |
| InChI | InChI=1S/C13H12N6S/c1-2-4-9(5-3-1)11-13-17-16-12(10-8-20-18-15-10)19(13)7-6-14-11/h1-5,8,11,14H,6-7H2 |
| InChIKey | OKLXUOFNHYUSCP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |