About ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate
ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate (PubChem CID 65216251) has the molecular formula C7H7N5O2S
and a molecular weight of 225.23 g/mol. Its IUPAC name is ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate |
| PubChem CID | 65216251 |
| Molecular Formula | C7H7N5O2S |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2csnn2)n[nH]1 |
| InChI | InChI=1S/C7H7N5O2S/c1-2-14-7(13)6-8-5(10-11-6)4-3-15-12-9-4/h3H,2H2,1H3,(H,8,10,11) |
| InChIKey | JVOBWYIIJURHDT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate?
The IUPAC name of ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate (CID 65216251) is ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate.
What is the SMILES notation for ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate?
The canonical SMILES for ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate is CCOC(=O)c1nc(-c2csnn2)n[nH]1.
What is the InChIKey of ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate?
The InChIKey is JVOBWYIIJURHDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O2S/c1-2-14-7(13)6-8-5(10-11-6)4-3-15-12-9-4/h3H,2H2,1H3,(H,8,10,11).
What are the key properties of ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate?
ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate has a molecular weight of 225.23 g/mol, XLogP of 0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate is sourced from PubChem (CID 65216251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).