About N'-hydroxypropanimidamide
N'-hydroxypropanimidamide (PubChem CID 6521662) has the molecular formula C3H8N2O
and a molecular weight of 88.11 g/mol. Its IUPAC name is N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | N'-hydroxypropanimidamide |
| PubChem CID | 6521662 |
| Molecular Formula | C3H8N2O |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.06 |
| IUPAC Name | N'-hydroxypropanimidamide |
| SMILES | CC/C(N)=N/O |
| InChI | InChI=1S/C3H8N2O/c1-2-3(4)5-6/h6H,2H2,1H3,(H2,4,5) |
| InChIKey | RLZPCFQNZGINRP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxypropanimidamide?
The IUPAC name of N'-hydroxypropanimidamide (CID 6521662) is N'-hydroxypropanimidamide.
What is the SMILES notation for N'-hydroxypropanimidamide?
The canonical SMILES for N'-hydroxypropanimidamide is CC/C(N)=N/O.
What is the InChIKey of N'-hydroxypropanimidamide?
The InChIKey is RLZPCFQNZGINRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O/c1-2-3(4)5-6/h6H,2H2,1H3,(H2,4,5).
What are the key properties of N'-hydroxypropanimidamide?
N'-hydroxypropanimidamide has a molecular weight of 88.11 g/mol, XLogP of 0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxypropanimidamide is sourced from PubChem (CID 6521662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).