C14H19NO5S — CID 65217875
2-[[(2-methyl-5-methylsulfonylbenzoyl)amino]methyl]butanoic acid (PubChem CID 65217875) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-[[(2-methyl-5-methylsulfonylbenzoyl)amino]methyl]butanoic acid.
| Compound Name | 2-[[(2-methyl-5-methylsulfonylbenzoyl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 65217875 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[[(2-methyl-5-methylsulfonylbenzoyl)amino]methyl]butanoic acid |
| SMILES | CCC(CNC(=O)c1cc(S(C)(=O)=O)ccc1C)C(=O)O |
| InChI | InChI=1S/C14H19NO5S/c1-4-10(14(17)18)8-15-13(16)12-7-11(21(3,19)20)6-5-9(12)2/h5-7,10H,4,8H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | BJUPDHWYEDVRAF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |