About (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate
(2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate (PubChem CID 652180) has the molecular formula C19H17N3O4S
and a molecular weight of 383.43 g/mol. Its IUPAC name is (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate.
Molecular Properties
| Compound Name | (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate |
| PubChem CID | 652180 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate |
| SMILES | C/N=C(/Nc1ccc2c(c1)OCO2)SC1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H17N3O4S/c1-20-19(21-12-7-8-14-15(9-12)26-11-25-14)27-16-10-17(23)22(18(16)24)13-5-3-2-4-6-13/h2-9,16H,10-11H2,1H3,(H,20,21) |
| InChIKey | OSDYIWFZKNEIDO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate?
The IUPAC name of (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate (CID 652180) is (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate.
What is the SMILES notation for (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate?
The canonical SMILES for (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate is C/N=C(/Nc1ccc2c(c1)OCO2)SC1CC(=O)N(c2ccccc2)C1=O.
What is the InChIKey of (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate?
The InChIKey is OSDYIWFZKNEIDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O4S/c1-20-19(21-12-7-8-14-15(9-12)26-11-25-14)27-16-10-17(23)22(18(16)24)13-5-3-2-4-6-13/h2-9,16H,10-11H2,1H3,(H,20,21).
What are the key properties of (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate?
(2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate has a molecular weight of 383.43 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxo-1-phenylpyrrolidin-3-yl) N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate is sourced from PubChem (CID 652180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).