C15H18N4OS — CID 652194
2-[(5,6-diethyl-1,2,4-triazin-3-yl)sulfanyl]-N-phenylacetamide (PubChem CID 652194) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[(5,6-diethyl-1,2,4-triazin-3-yl)sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[(5,6-diethyl-1,2,4-triazin-3-yl)sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 652194 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-[(5,6-diethyl-1,2,4-triazin-3-yl)sulfanyl]-N-phenylacetamide |
| SMILES | CCc1nnc(SCC(=O)Nc2ccccc2)nc1CC |
| InChI | InChI=1S/C15H18N4OS/c1-3-12-13(4-2)18-19-15(17-12)21-10-14(20)16-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H,16,20) |
| InChIKey | IGJNTIZKIRCMSJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |