About 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine
2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine (PubChem CID 65228088) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine |
| PubChem CID | 65228088 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine |
| SMILES | C=CCN(CC=C)CC(CN)C(C)C |
| InChI | InChI=1S/C12H24N2/c1-5-7-14(8-6-2)10-12(9-13)11(3)4/h5-6,11-12H,1-2,7-10,13H2,3-4H3 |
| InChIKey | IYXKOLXCBNHFGL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine?
The IUPAC name of 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine (CID 65228088) is 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine.
What is the SMILES notation for 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine?
The canonical SMILES for 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine is C=CCN(CC=C)CC(CN)C(C)C.
What is the InChIKey of 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine?
The InChIKey is IYXKOLXCBNHFGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-5-7-14(8-6-2)10-12(9-13)11(3)4/h5-6,11-12H,1-2,7-10,13H2,3-4H3.
What are the key properties of 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine?
2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine has a molecular weight of 196.34 g/mol, XLogP of 1.89, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-N',N'-bis(prop-2-enyl)propane-1,3-diamine is sourced from PubChem (CID 65228088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).