About (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one
(3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one (PubChem CID 6523018) has the molecular formula C22H21Cl2NO
and a molecular weight of 386.32 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one.
Molecular Properties
| Compound Name | (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one |
| PubChem CID | 6523018 |
| Molecular Formula | C22H21Cl2NO |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one |
| SMILES | CCCN1C/C(=C\c2ccccc2Cl)C(=O)/C(=C/c2ccccc2Cl)C1 |
| InChI | InChI=1S/C22H21Cl2NO/c1-2-11-25-14-18(12-16-7-3-5-9-20(16)23)22(26)19(15-25)13-17-8-4-6-10-21(17)24/h3-10,12-13H,2,11,14-15H2,1H3/b18-12+,19-13+ |
| InChIKey | LFXTZVSZMVGFOZ-KLCVKJMQSA-N |
| XLogP | 5.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one?
The IUPAC name of (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one (CID 6523018) is (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one.
What is the SMILES notation for (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one?
The canonical SMILES for (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one is CCCN1C/C(=C\c2ccccc2Cl)C(=O)/C(=C/c2ccccc2Cl)C1.
What is the InChIKey of (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one?
The InChIKey is LFXTZVSZMVGFOZ-KLCVKJMQSA-N. The full InChI is InChI=1S/C22H21Cl2NO/c1-2-11-25-14-18(12-16-7-3-5-9-20(16)23)22(26)19(15-25)13-17-8-4-6-10-21(17)24/h3-10,12-13H,2,11,14-15H2,1H3/b18-12+,19-13+.
What are the key properties of (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one?
(3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one has a molecular weight of 386.32 g/mol, XLogP of 5.76, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]-1-propylpiperidin-4-one is sourced from PubChem (CID 6523018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).