C13H15Cl2N3 — CID 65232570
2-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]butan-1-amine (PubChem CID 65232570) has the molecular formula C13H15Cl2N3 and a molecular weight of 284.19 g/mol. Its IUPAC name is 2-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]butan-1-amine.
| Compound Name | 2-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]butan-1-amine |
|---|---|
| PubChem CID | 65232570 |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]butan-1-amine |
| SMILES | CCC(CN)c1ncc(-c2ccc(Cl)c(Cl)c2)[nH]1 |
| InChI | InChI=1S/C13H15Cl2N3/c1-2-8(6-16)13-17-7-12(18-13)9-3-4-10(14)11(15)5-9/h3-5,7-8H,2,6,16H2,1H3,(H,17,18) |
| InChIKey | SOXAAHMTBNWMCL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |