About 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine
2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine (PubChem CID 65232884) has the molecular formula C9H17N3S
and a molecular weight of 199.32 g/mol. Its IUPAC name is 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine |
| PubChem CID | 65232884 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine |
| SMILES | CCC(CN)CNCc1nccs1 |
| InChI | InChI=1S/C9H17N3S/c1-2-8(5-10)6-11-7-9-12-3-4-13-9/h3-4,8,11H,2,5-7,10H2,1H3 |
| InChIKey | SVHBUEPOEBKAIK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine?
The IUPAC name of 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine (CID 65232884) is 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine.
What is the SMILES notation for 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine?
The canonical SMILES for 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine is CCC(CN)CNCc1nccs1.
What is the InChIKey of 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine?
The InChIKey is SVHBUEPOEBKAIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3S/c1-2-8(5-10)6-11-7-9-12-3-4-13-9/h3-4,8,11H,2,5-7,10H2,1H3.
What are the key properties of 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine?
2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine has a molecular weight of 199.32 g/mol, XLogP of 1.22, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine is sourced from PubChem (CID 65232884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).