C11H13F3N2O — CID 65233734
3-(ethylamino)-3-(3,4,5-trifluorophenyl)propanamide (PubChem CID 65233734) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-(ethylamino)-3-(3,4,5-trifluorophenyl)propanamide.
| Compound Name | 3-(ethylamino)-3-(3,4,5-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 65233734 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-(ethylamino)-3-(3,4,5-trifluorophenyl)propanamide |
| SMILES | CCNC(CC(N)=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H13F3N2O/c1-2-16-9(5-10(15)17)6-3-7(12)11(14)8(13)4-6/h3-4,9,16H,2,5H2,1H3,(H2,15,17) |
| InChIKey | KOLXUGRUNAXKIH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|