C11H24N2O2 — CID 65234064
3-(ethylamino)-5-methoxy-3,5-dimethylhexanamide (PubChem CID 65234064) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-(ethylamino)-5-methoxy-3,5-dimethylhexanamide.
| Compound Name | 3-(ethylamino)-5-methoxy-3,5-dimethylhexanamide |
|---|---|
| PubChem CID | 65234064 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-(ethylamino)-5-methoxy-3,5-dimethylhexanamide |
| SMILES | CCNC(C)(CC(N)=O)CC(C)(C)OC |
| InChI | InChI=1S/C11H24N2O2/c1-6-13-11(4,7-9(12)14)8-10(2,3)15-5/h13H,6-8H2,1-5H3,(H2,12,14) |
| InChIKey | GFICAKBDQUSHQW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |