About 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide
2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide (PubChem CID 652342) has the molecular formula C11H15N5O
and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide |
| PubChem CID | 652342 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide |
| SMILES | Cc1nn(C)c(C)c1NC(=O)c1ccnn1C |
| InChI | InChI=1S/C11H15N5O/c1-7-10(8(2)15(3)14-7)13-11(17)9-5-6-12-16(9)4/h5-6H,1-4H3,(H,13,17) |
| InChIKey | FYAIGCZBRGMVDP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide?
The IUPAC name of 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide (CID 652342) is 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide.
What is the SMILES notation for 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide?
The canonical SMILES for 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide is Cc1nn(C)c(C)c1NC(=O)c1ccnn1C.
What is the InChIKey of 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide?
The InChIKey is FYAIGCZBRGMVDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O/c1-7-10(8(2)15(3)14-7)13-11(17)9-5-6-12-16(9)4/h5-6H,1-4H3,(H,13,17).
What are the key properties of 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide?
2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide has a molecular weight of 233.27 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)pyrazole-3-carboxamide is sourced from PubChem (CID 652342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).