About ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate
ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate (PubChem CID 65235737) has the molecular formula C16H23NO3
and a molecular weight of 277.36 g/mol. Its IUPAC name is ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate |
| PubChem CID | 65235737 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate |
| SMILES | CCCNC1(CC(=O)OCC)CCOc2ccccc21 |
| InChI | InChI=1S/C16H23NO3/c1-3-10-17-16(12-15(18)19-4-2)9-11-20-14-8-6-5-7-13(14)16/h5-8,17H,3-4,9-12H2,1-2H3 |
| InChIKey | CWOKWXHVMRLXFS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate?
The IUPAC name of ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate (CID 65235737) is ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate.
What is the SMILES notation for ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate?
The canonical SMILES for ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate is CCCNC1(CC(=O)OCC)CCOc2ccccc21.
What is the InChIKey of ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate?
The InChIKey is CWOKWXHVMRLXFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3/c1-3-10-17-16(12-15(18)19-4-2)9-11-20-14-8-6-5-7-13(14)16/h5-8,17H,3-4,9-12H2,1-2H3.
What are the key properties of ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate?
ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate has a molecular weight of 277.36 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-(propylamino)-2,3-dihydrochromen-4-yl]acetate is sourced from PubChem (CID 65235737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).