C16H31NO2 — CID 65235940
ethyl 2-[4,4-dimethyl-1-(propylamino)cycloheptyl]acetate (PubChem CID 65235940) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is ethyl 2-[4,4-dimethyl-1-(propylamino)cycloheptyl]acetate.
| Compound Name | ethyl 2-[4,4-dimethyl-1-(propylamino)cycloheptyl]acetate |
|---|---|
| PubChem CID | 65235940 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | ethyl 2-[4,4-dimethyl-1-(propylamino)cycloheptyl]acetate |
| SMILES | CCCNC1(CC(=O)OCC)CCCC(C)(C)CC1 |
| InChI | InChI=1S/C16H31NO2/c1-5-12-17-16(13-14(18)19-6-2)9-7-8-15(3,4)10-11-16/h17H,5-13H2,1-4H3 |
| InChIKey | VCVRMUIQGLCNBY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |