About 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole
2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole (PubChem CID 65237877) has the molecular formula C8H7ClN2S2
and a molecular weight of 230.75 g/mol. Its IUPAC name is 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole |
| PubChem CID | 65237877 |
| Molecular Formula | C8H7ClN2S2 |
| Molecular Weight | 230.75 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole |
| SMILES | Cc1cc(-c2nnc(Cl)s2)sc1C |
| InChI | InChI=1S/C8H7ClN2S2/c1-4-3-6(12-5(4)2)7-10-11-8(9)13-7/h3H,1-2H3 |
| InChIKey | QZZQVCBZTJCCGD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole?
The IUPAC name of 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole (CID 65237877) is 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole?
The canonical SMILES for 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole is Cc1cc(-c2nnc(Cl)s2)sc1C.
What is the InChIKey of 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole?
The InChIKey is QZZQVCBZTJCCGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2S2/c1-4-3-6(12-5(4)2)7-10-11-8(9)13-7/h3H,1-2H3.
What are the key properties of 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole?
2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole has a molecular weight of 230.75 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(4,5-dimethylthiophen-2-yl)-1,3,4-thiadiazole is sourced from PubChem (CID 65237877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).