About 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene
5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene (PubChem CID 65237949) has the molecular formula C16H19BrOS
and a molecular weight of 339.30 g/mol. Its IUPAC name is 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene.
Molecular Properties
| Compound Name | 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene |
| PubChem CID | 65237949 |
| Molecular Formula | C16H19BrOS |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene |
| SMILES | Cc1cc(C(Br)c2ccc(OC(C)C)cc2)sc1C |
| InChI | InChI=1S/C16H19BrOS/c1-10(2)18-14-7-5-13(6-8-14)16(17)15-9-11(3)12(4)19-15/h5-10,16H,1-4H3 |
| InChIKey | MEJDSQOCFRSEJQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene?
The IUPAC name of 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene (CID 65237949) is 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene.
What is the SMILES notation for 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene?
The canonical SMILES for 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene is Cc1cc(C(Br)c2ccc(OC(C)C)cc2)sc1C.
What is the InChIKey of 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene?
The InChIKey is MEJDSQOCFRSEJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrOS/c1-10(2)18-14-7-5-13(6-8-14)16(17)15-9-11(3)12(4)19-15/h5-10,16H,1-4H3.
What are the key properties of 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene?
5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene has a molecular weight of 339.30 g/mol, XLogP of 5.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene is sourced from PubChem (CID 65237949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).