C16H19BrOS — CID 65237949
5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene (PubChem CID 65237949) has the molecular formula C16H19BrOS and a molecular weight of 339.30 g/mol. Its IUPAC name is 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene.
| Compound Name | 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene |
|---|---|
| PubChem CID | 65237949 |
| Molecular Formula | C16H19BrOS |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 5-[bromo-(4-propan-2-yloxyphenyl)methyl]-2,3-dimethylthiophene |
| SMILES | Cc1cc(C(Br)c2ccc(OC(C)C)cc2)sc1C |
| InChI | InChI=1S/C16H19BrOS/c1-10(2)18-14-7-5-13(6-8-14)16(17)15-9-11(3)12(4)19-15/h5-10,16H,1-4H3 |
| InChIKey | MEJDSQOCFRSEJQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|