About 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid
2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid (PubChem CID 65238012) has the molecular formula C11H11NO3S
and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid |
| PubChem CID | 65238012 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid |
| SMILES | Cc1cc(-c2nc(C(=O)O)c(C)o2)sc1C |
| InChI | InChI=1S/C11H11NO3S/c1-5-4-8(16-7(5)3)10-12-9(11(13)14)6(2)15-10/h4H,1-3H3,(H,13,14) |
| InChIKey | PDMHYMMVULUQLP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid (CID 65238012) is 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid is Cc1cc(-c2nc(C(=O)O)c(C)o2)sc1C.
What is the InChIKey of 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid?
The InChIKey is PDMHYMMVULUQLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c1-5-4-8(16-7(5)3)10-12-9(11(13)14)6(2)15-10/h4H,1-3H3,(H,13,14).
What are the key properties of 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid?
2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid has a molecular weight of 237.28 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethylthiophen-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 65238012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).