C10H12N4O2 — CID 652386
5-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-amine (PubChem CID 652386) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 652386 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-amine |
| SMILES | COc1ccc(-c2nc(N)n[nH]2)cc1OC |
| InChI | InChI=1S/C10H12N4O2/c1-15-7-4-3-6(5-8(7)16-2)9-12-10(11)14-13-9/h3-5H,1-2H3,(H3,11,12,13,14) |
| InChIKey | AHCGZNXGBCOYSI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |