C11H15N3S — CID 65238773
3-(4,5-dimethylthiophen-2-yl)-5-propyl-1H-1,2,4-triazole (PubChem CID 65238773) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 3-(4,5-dimethylthiophen-2-yl)-5-propyl-1H-1,2,4-triazole.
| Compound Name | 3-(4,5-dimethylthiophen-2-yl)-5-propyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 65238773 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3-(4,5-dimethylthiophen-2-yl)-5-propyl-1H-1,2,4-triazole |
| SMILES | CCCc1nc(-c2cc(C)c(C)s2)n[nH]1 |
| InChI | InChI=1S/C11H15N3S/c1-4-5-10-12-11(14-13-10)9-6-7(2)8(3)15-9/h6H,4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | AAAVGYLHFLZNQA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |