About 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile
4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile (PubChem CID 65239471) has the molecular formula C11H9N3O
and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile |
| PubChem CID | 65239471 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2oncc2CN)cc1 |
| InChI | InChI=1S/C11H9N3O/c12-5-8-1-3-9(4-2-8)11-10(6-13)7-14-15-11/h1-4,7H,6,13H2 |
| InChIKey | IHGYWQHDGQTWLY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile?
The IUPAC name of 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile (CID 65239471) is 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile.
What is the SMILES notation for 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile?
The canonical SMILES for 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile is N#Cc1ccc(-c2oncc2CN)cc1.
What is the InChIKey of 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile?
The InChIKey is IHGYWQHDGQTWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O/c12-5-8-1-3-9(4-2-8)11-10(6-13)7-14-15-11/h1-4,7H,6,13H2.
What are the key properties of 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile?
4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile has a molecular weight of 199.21 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(aminomethyl)-1,2-oxazol-5-yl]benzonitrile is sourced from PubChem (CID 65239471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).