About 3-amino-3,4-diphenylbutan-1-ol
3-amino-3,4-diphenylbutan-1-ol (PubChem CID 65239678) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is 3-amino-3,4-diphenylbutan-1-ol.
Molecular Properties
| Compound Name | 3-amino-3,4-diphenylbutan-1-ol |
| PubChem CID | 65239678 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 3-amino-3,4-diphenylbutan-1-ol |
| SMILES | NC(CCO)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19NO/c17-16(11-12-18,15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-10,18H,11-13,17H2 |
| InChIKey | FXDLIYLNQAUPQN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-3,4-diphenylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3,4-diphenylbutan-1-ol?
The IUPAC name of 3-amino-3,4-diphenylbutan-1-ol (CID 65239678) is 3-amino-3,4-diphenylbutan-1-ol.
What is the SMILES notation for 3-amino-3,4-diphenylbutan-1-ol?
The canonical SMILES for 3-amino-3,4-diphenylbutan-1-ol is NC(CCO)(Cc1ccccc1)c1ccccc1.
What is the InChIKey of 3-amino-3,4-diphenylbutan-1-ol?
The InChIKey is FXDLIYLNQAUPQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO/c17-16(11-12-18,15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-10,18H,11-13,17H2.
What are the key properties of 3-amino-3,4-diphenylbutan-1-ol?
3-amino-3,4-diphenylbutan-1-ol has a molecular weight of 241.33 g/mol, XLogP of 2.47, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3,4-diphenylbutan-1-ol is sourced from PubChem (CID 65239678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).